C21H24F2N4O3 — CID 130408700
N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]pyrrole-2-carboxamide (PubChem CID 130408700) has the molecular formula C21H24F2N4O3 and a molecular weight of 418.44 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]pyrrole-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130408700 |
| Molecular Formula | C21H24F2N4O3 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]pyrrole-2-carboxamide |
| SMILES | Cc1c(C(=O)C(=O)N2CCN(C)CC2)c(C)n(C)c1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H24F2N4O3/c1-12-17(19(28)21(30)27-9-7-25(3)8-10-27)13(2)26(4)18(12)20(29)24-14-5-6-15(22)16(23)11-14/h5-6,11H,7-10H2,1-4H3,(H,24,29) |
| InChIKey | RXUJGDHBZFCUGK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|