C23H25NO6 — CID 130409062
(2R,3S,4S,5S,6R)-2-[(R)-hydroxy-(4-isoquinolin-5-yl-2-methylphenyl)methyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 130409062) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[(R)-hydroxy-(4-isoquinolin-5-yl-2-methylphenyl)methyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[(R)-hydroxy-(4-isoquinolin-5-yl-2-methylphenyl)methyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 130409062 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[(R)-hydroxy-(4-isoquinolin-5-yl-2-methylphenyl)methyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc(-c2cccc3cnccc23)ccc1[C@@H](O)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H25NO6/c1-12-9-13(16-4-2-3-14-10-24-8-7-17(14)16)5-6-15(12)19(26)23-22(29)21(28)20(27)18(11-25)30-23/h2-10,18-23,25-29H,11H2,1H3/t18-,19-,20-,21+,22+,23-/m1/s1 |
| InChIKey | UXVMTOZAOWRMRY-LAAXVVMPSA-N |
| XLogP | 1.09 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |