C23H34FNO14 — CID 130409499
methyl (2R,5S)-4-acetyloxy-3-fluoro-2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 130409499) has the molecular formula C23H34FNO14 and a molecular weight of 567.52 g/mol. Its IUPAC name is methyl (2R,5S)-4-acetyloxy-3-fluoro-2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,5S)-4-acetyloxy-3-fluoro-2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 130409499 |
| Molecular Formula | C23H34FNO14 |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | methyl (2R,5S)-4-acetyloxy-3-fluoro-2-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(O)OC([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](NC(=O)OC(C)(C)C)C(OC(C)=O)C1F |
| InChI | InChI=1S/C23H34FNO14/c1-10(26)34-9-14(35-11(2)27)16(36-12(3)28)17-15(25-21(31)39-22(5,6)7)18(37-13(4)29)19(24)23(32,38-17)20(30)33-8/h14-19,32H,9H2,1-8H3,(H,25,31)/t14-,15+,16-,17?,18?,19?,23+/m1/s1 |
| InChIKey | LVFWKFVYWANZPE-PUYJZUHCSA-N |
| XLogP | -0.16 |
| TPSA | 199.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|