About N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine
N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 130409626) has the molecular formula C15H21ClF3N
and a molecular weight of 307.79 g/mol. Its IUPAC name is N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine |
| PubChem CID | 130409626 |
| Molecular Formula | C15H21ClF3N |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | CCC(C)N(CCCC(F)(F)F)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClF3N/c1-3-12(2)20(10-4-9-15(17,18)19)11-13-5-7-14(16)8-6-13/h5-8,12H,3-4,9-11H2,1-2H3 |
| InChIKey | CJRUGGCOPDSXSY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine?
The IUPAC name of N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine (CID 130409626) is N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine.
What is the SMILES notation for N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine?
The canonical SMILES for N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine is CCC(C)N(CCCC(F)(F)F)Cc1ccc(Cl)cc1.
What is the InChIKey of N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine?
The InChIKey is CJRUGGCOPDSXSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClF3N/c1-3-12(2)20(10-4-9-15(17,18)19)11-13-5-7-14(16)8-6-13/h5-8,12H,3-4,9-11H2,1-2H3.
What are the key properties of N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine?
N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine has a molecular weight of 307.79 g/mol, XLogP of 5.28, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-N-[(4-chlorophenyl)methyl]-4,4,4-trifluorobutan-1-amine is sourced from PubChem (CID 130409626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).