About 1-iodo-4-methyl-1,4-diazepan-6-ol
1-iodo-4-methyl-1,4-diazepan-6-ol (PubChem CID 130410427) has the molecular formula C6H13IN2O
and a molecular weight of 256.09 g/mol. Its IUPAC name is 1-iodo-4-methyl-1,4-diazepan-6-ol.
Molecular Properties
| Compound Name | 1-iodo-4-methyl-1,4-diazepan-6-ol |
| PubChem CID | 130410427 |
| Molecular Formula | C6H13IN2O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 1-iodo-4-methyl-1,4-diazepan-6-ol |
| SMILES | CN1CCN(I)CC(O)C1 |
| InChI | InChI=1S/C6H13IN2O/c1-8-2-3-9(7)5-6(10)4-8/h6,10H,2-5H2,1H3 |
| InChIKey | IELRANUPCAZKJV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-4-methyl-1,4-diazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-4-methyl-1,4-diazepan-6-ol?
The IUPAC name of 1-iodo-4-methyl-1,4-diazepan-6-ol (CID 130410427) is 1-iodo-4-methyl-1,4-diazepan-6-ol.
What is the SMILES notation for 1-iodo-4-methyl-1,4-diazepan-6-ol?
The canonical SMILES for 1-iodo-4-methyl-1,4-diazepan-6-ol is CN1CCN(I)CC(O)C1.
What is the InChIKey of 1-iodo-4-methyl-1,4-diazepan-6-ol?
The InChIKey is IELRANUPCAZKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13IN2O/c1-8-2-3-9(7)5-6(10)4-8/h6,10H,2-5H2,1H3.
What are the key properties of 1-iodo-4-methyl-1,4-diazepan-6-ol?
1-iodo-4-methyl-1,4-diazepan-6-ol has a molecular weight of 256.09 g/mol, XLogP of -0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-4-methyl-1,4-diazepan-6-ol is sourced from PubChem (CID 130410427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).