About (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate
(8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate (PubChem CID 130410916) has the molecular formula C16H19F2NO2
and a molecular weight of 295.33 g/mol. Its IUPAC name is (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate.
Molecular Properties
| Compound Name | (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate |
| PubChem CID | 130410916 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate |
| SMILES | CC(=O)OC1CCC2CC(F)(F)C1N2Cc1ccccc1 |
| InChI | InChI=1S/C16H19F2NO2/c1-11(20)21-14-8-7-13-9-16(17,18)15(14)19(13)10-12-5-3-2-4-6-12/h2-6,13-15H,7-10H2,1H3 |
| InChIKey | COPARCLIJVHYBX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate?
The IUPAC name of (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate (CID 130410916) is (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate.
What is the SMILES notation for (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate?
The canonical SMILES for (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate is CC(=O)OC1CCC2CC(F)(F)C1N2Cc1ccccc1.
What is the InChIKey of (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate?
The InChIKey is COPARCLIJVHYBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2NO2/c1-11(20)21-14-8-7-13-9-16(17,18)15(14)19(13)10-12-5-3-2-4-6-12/h2-6,13-15H,7-10H2,1H3.
What are the key properties of (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate?
(8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate has a molecular weight of 295.33 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-benzyl-7,7-difluoro-8-azabicyclo[3.2.1]octan-2-yl) acetate is sourced from PubChem (CID 130410916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).