C48H42O4 — CID 130411241
[4-[11-(2,2-dimethylpropanoyloxy)-11-ethenylbenzo[a]fluoren-8-yl]-7-ethenylbenzo[c]fluoren-7-yl] 2,2-dimethylpropanoate (PubChem CID 130411241) has the molecular formula C48H42O4 and a molecular weight of 682.86 g/mol. Its IUPAC name is [4-[11-(2,2-dimethylpropanoyloxy)-11-ethenylbenzo[a]fluoren-8-yl]-7-ethenylbenzo[c]fluoren-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[11-(2,2-dimethylpropanoyloxy)-11-ethenylbenzo[a]fluoren-8-yl]-7-ethenylbenzo[c]fluoren-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 130411241 |
| Molecular Formula | C48H42O4 |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | [4-[11-(2,2-dimethylpropanoyloxy)-11-ethenylbenzo[a]fluoren-8-yl]-7-ethenylbenzo[c]fluoren-7-yl] 2,2-dimethylpropanoate |
| SMILES | C=CC1(OC(=O)C(C)(C)C)c2ccccc2-c2c1ccc1c(-c3ccc4c(c3)-c3ccc5ccccc5c3C4(C=C)OC(=O)C(C)(C)C)cccc21 |
| InChI | InChI=1S/C48H42O4/c1-9-47(51-43(49)45(3,4)5)38-21-14-13-18-36(38)41-34-20-15-19-31(33(34)25-27-40(41)47)30-23-26-39-37(28-30)35-24-22-29-16-11-12-17-32(29)42(35)48(39,10-2)52-44(50)46(6,7)8/h9-28H,1-2H2,3-8H3 |
| InChIKey | CWPWRYCCAWEYIH-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|