About [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate
[3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate (PubChem CID 130411255) has the molecular formula C22H24O5
and a molecular weight of 368.43 g/mol. Its IUPAC name is [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate |
| PubChem CID | 130411255 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C)c2ccc(COC)cc2Oc2c(COC)cccc21 |
| InChI | InChI=1S/C22H24O5/c1-14(2)21(23)27-22(3)17-10-9-15(12-24-4)11-19(17)26-20-16(13-25-5)7-6-8-18(20)22/h6-11H,1,12-13H2,2-5H3 |
| InChIKey | SJMQHYYUTVYGCQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate?
The IUPAC name of [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate (CID 130411255) is [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate?
The canonical SMILES for [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC1(C)c2ccc(COC)cc2Oc2c(COC)cccc21.
What is the InChIKey of [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate?
The InChIKey is SJMQHYYUTVYGCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O5/c1-14(2)21(23)27-22(3)17-10-9-15(12-24-4)11-19(17)26-20-16(13-25-5)7-6-8-18(20)22/h6-11H,1,12-13H2,2-5H3.
What are the key properties of [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate?
[3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate has a molecular weight of 368.43 g/mol, XLogP of 4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(methoxymethyl)-9-methylxanthen-9-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 130411255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).