About 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde
4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 130411303) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 130411303 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | COC1=CC(O)=CC(OC)C1C=O |
| InChI | InChI=1S/C9H12O4/c1-12-8-3-6(11)4-9(13-2)7(8)5-10/h3-5,7-8,11H,1-2H3 |
| InChIKey | IDTKNWJIOPVDII-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde (CID 130411303) is 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde is COC1=CC(O)=CC(OC)C1C=O.
What is the InChIKey of 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is IDTKNWJIOPVDII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-12-8-3-6(11)4-9(13-2)7(8)5-10/h3-5,7-8,11H,1-2H3.
What are the key properties of 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde?
4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 184.19 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,6-dimethoxycyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 130411303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).