C19H18F12O8 — CID 130411759
2-O-(2-acetyloxyethyl) 1-O,4-O-bis(1,1,1,3,3,3-hexafluoropropan-2-yl) cyclohexane-1,2,4-tricarboxylate (PubChem CID 130411759) has the molecular formula C19H18F12O8 and a molecular weight of 602.32 g/mol. Its IUPAC name is 2-O-(2-acetyloxyethyl) 1-O,4-O-bis(1,1,1,3,3,3-hexafluoropropan-2-yl) cyclohexane-1,2,4-tricarboxylate.
| Compound Name | 2-O-(2-acetyloxyethyl) 1-O,4-O-bis(1,1,1,3,3,3-hexafluoropropan-2-yl) cyclohexane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 130411759 |
| Molecular Formula | C19H18F12O8 |
| Molecular Weight | 602.32 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | 2-O-(2-acetyloxyethyl) 1-O,4-O-bis(1,1,1,3,3,3-hexafluoropropan-2-yl) cyclohexane-1,2,4-tricarboxylate |
| SMILES | CC(=O)OCCOC(=O)C1CC(C(=O)OC(C(F)(F)F)C(F)(F)F)CCC1C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H18F12O8/c1-7(32)36-4-5-37-12(34)10-6-8(11(33)38-14(16(20,21)22)17(23,24)25)2-3-9(10)13(35)39-15(18(26,27)28)19(29,30)31/h8-10,14-15H,2-6H2,1H3 |
| InChIKey | IZZITLSAIYUTOC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|