C21H20F12O8 — CID 130411795
1-O,3-O-bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,3,5-tricarboxylate (PubChem CID 130411795) has the molecular formula C21H20F12O8 and a molecular weight of 628.36 g/mol. Its IUPAC name is 1-O,3-O-bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,3,5-tricarboxylate.
| Compound Name | 1-O,3-O-bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 130411795 |
| Molecular Formula | C21H20F12O8 |
| Molecular Weight | 628.36 g/mol |
| Exact Mass | 628.10 |
| IUPAC Name | 1-O,3-O-bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 5-O-[2-(2-methylprop-2-enoyloxy)ethyl] cyclohexane-1,3,5-tricarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C1CC(C(=O)OC(C(F)(F)F)C(F)(F)F)CC(C(=O)OC(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C21H20F12O8/c1-8(2)12(34)38-3-4-39-13(35)9-5-10(14(36)40-16(18(22,23)24)19(25,26)27)7-11(6-9)15(37)41-17(20(28,29)30)21(31,32)33/h9-11,16-17H,1,3-7H2,2H3 |
| InChIKey | DRFFDOCCOSKGTG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|