About 3-iodobicyclo[3.2.0]hepta-1(5),2-diene
3-iodobicyclo[3.2.0]hepta-1(5),2-diene (PubChem CID 130412402) has the molecular formula C7H7I
and a molecular weight of 218.04 g/mol. Its IUPAC name is 3-iodobicyclo[3.2.0]hepta-1(5),2-diene.
Molecular Properties
| Compound Name | 3-iodobicyclo[3.2.0]hepta-1(5),2-diene |
| PubChem CID | 130412402 |
| Molecular Formula | C7H7I |
| Molecular Weight | 218.04 g/mol |
| Exact Mass | 217.96 |
| IUPAC Name | 3-iodobicyclo[3.2.0]hepta-1(5),2-diene |
| SMILES | IC1=CC2=C(CC2)C1 |
| InChI | InChI=1S/C7H7I/c8-7-3-5-1-2-6(5)4-7/h3H,1-2,4H2 |
| InChIKey | INDFVARIXWROAR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.04 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodobicyclo[3.2.0]hepta-1(5),2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodobicyclo[3.2.0]hepta-1(5),2-diene?
The IUPAC name of 3-iodobicyclo[3.2.0]hepta-1(5),2-diene (CID 130412402) is 3-iodobicyclo[3.2.0]hepta-1(5),2-diene.
What is the SMILES notation for 3-iodobicyclo[3.2.0]hepta-1(5),2-diene?
The canonical SMILES for 3-iodobicyclo[3.2.0]hepta-1(5),2-diene is IC1=CC2=C(CC2)C1.
What is the InChIKey of 3-iodobicyclo[3.2.0]hepta-1(5),2-diene?
The InChIKey is INDFVARIXWROAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7I/c8-7-3-5-1-2-6(5)4-7/h3H,1-2,4H2.
What are the key properties of 3-iodobicyclo[3.2.0]hepta-1(5),2-diene?
3-iodobicyclo[3.2.0]hepta-1(5),2-diene has a molecular weight of 218.04 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodobicyclo[3.2.0]hepta-1(5),2-diene is sourced from PubChem (CID 130412402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).