C24H41N — CID 130412521
(3E,4Z)-N-butyl-3-ethylidene-6-methylidene-N,8-dipropylundeca-1,4,10-trien-2-amine (PubChem CID 130412521) has the molecular formula C24H41N and a molecular weight of 343.60 g/mol. Its IUPAC name is (3E,4Z)-N-butyl-3-ethylidene-6-methylidene-N,8-dipropylundeca-1,4,10-trien-2-amine.
| Compound Name | (3E,4Z)-N-butyl-3-ethylidene-6-methylidene-N,8-dipropylundeca-1,4,10-trien-2-amine |
|---|---|
| PubChem CID | 130412521 |
| Molecular Formula | C24H41N |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.32 |
| IUPAC Name | (3E,4Z)-N-butyl-3-ethylidene-6-methylidene-N,8-dipropylundeca-1,4,10-trien-2-amine |
| SMILES | C=CCC(CCC)CC(=C)/C=C\C(=C/C)C(=C)N(CCC)CCCC |
| InChI | InChI=1S/C24H41N/c1-8-13-19-25(18-11-4)22(7)24(12-5)17-16-21(6)20-23(14-9-2)15-10-3/h9,12,16-17,23H,2,6-8,10-11,13-15,18-20H2,1,3-5H3/b17-16-,24-12+ |
| InChIKey | RNMINCJPADESGZ-YHANDMHRSA-N |
| XLogP | 7.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|