C26H32N8O3 — CID 130412802
2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]benzamide (PubChem CID 130412802) has the molecular formula C26H32N8O3 and a molecular weight of 504.60 g/mol. Its IUPAC name is 2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]benzamide.
| Compound Name | 2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 130412802 |
| Molecular Formula | C26H32N8O3 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]amino]benzamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(Nc3ccccc3C(N)=O)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C26H32N8O3/c1-6-24(35)30-19-15-20(22(37-5)16-21(19)34(4)14-13-33(2)3)31-26-28-12-11-23(32-26)29-18-10-8-7-9-17(18)25(27)36/h6-12,15-16H,1,13-14H2,2-5H3,(H2,27,36)(H,30,35)(H2,28,29,31,32) |
| InChIKey | PVHWNDJHAPJPML-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|