About 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine
2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine (PubChem CID 130412810) has the molecular formula C10H13ClN2
and a molecular weight of 196.68 g/mol. Its IUPAC name is 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine |
| PubChem CID | 130412810 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine |
| SMILES | CC/C=C\C=C/N1CC=CN=C1Cl |
| InChI | InChI=1S/C10H13ClN2/c1-2-3-4-5-8-13-9-6-7-12-10(13)11/h3-8H,2,9H2,1H3/b4-3-,8-5- |
| InChIKey | IAAVYGORAUUBLQ-UBNNFMAXSA-N |
| XLogP | 2.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine?
The IUPAC name of 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine (CID 130412810) is 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine.
What is the SMILES notation for 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine?
The canonical SMILES for 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine is CC/C=C\C=C/N1CC=CN=C1Cl.
What is the InChIKey of 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine?
The InChIKey is IAAVYGORAUUBLQ-UBNNFMAXSA-N. The full InChI is InChI=1S/C10H13ClN2/c1-2-3-4-5-8-13-9-6-7-12-10(13)11/h3-8H,2,9H2,1H3/b4-3-,8-5-.
What are the key properties of 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine?
2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine has a molecular weight of 196.68 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-[(1Z,3Z)-hexa-1,3-dienyl]-4H-pyrimidine is sourced from PubChem (CID 130412810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).