About 6-fluoro-2-methyl-8,8a-dihydroquinoline
6-fluoro-2-methyl-8,8a-dihydroquinoline (PubChem CID 130413071) has the molecular formula C10H10FN
and a molecular weight of 163.19 g/mol. Its IUPAC name is 6-fluoro-2-methyl-8,8a-dihydroquinoline.
Molecular Properties
| Compound Name | 6-fluoro-2-methyl-8,8a-dihydroquinoline |
| PubChem CID | 130413071 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 6-fluoro-2-methyl-8,8a-dihydroquinoline |
| SMILES | CC1=NC2CC=C(F)C=C2C=C1 |
| InChI | InChI=1S/C10H10FN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-4,6,10H,5H2,1H3 |
| InChIKey | FGFGPMQTIYOZSH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-2-methyl-8,8a-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-methyl-8,8a-dihydroquinoline?
The IUPAC name of 6-fluoro-2-methyl-8,8a-dihydroquinoline (CID 130413071) is 6-fluoro-2-methyl-8,8a-dihydroquinoline.
What is the SMILES notation for 6-fluoro-2-methyl-8,8a-dihydroquinoline?
The canonical SMILES for 6-fluoro-2-methyl-8,8a-dihydroquinoline is CC1=NC2CC=C(F)C=C2C=C1.
What is the InChIKey of 6-fluoro-2-methyl-8,8a-dihydroquinoline?
The InChIKey is FGFGPMQTIYOZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-4,6,10H,5H2,1H3.
What are the key properties of 6-fluoro-2-methyl-8,8a-dihydroquinoline?
6-fluoro-2-methyl-8,8a-dihydroquinoline has a molecular weight of 163.19 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-methyl-8,8a-dihydroquinoline is sourced from PubChem (CID 130413071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).