C11H14FN — CID 130413096
2-ethyl-6-fluoro-4a,5,8,8a-tetrahydroquinoline (PubChem CID 130413096) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 2-ethyl-6-fluoro-4a,5,8,8a-tetrahydroquinoline.
| Compound Name | 2-ethyl-6-fluoro-4a,5,8,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 130413096 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2-ethyl-6-fluoro-4a,5,8,8a-tetrahydroquinoline |
| SMILES | CCC1=NC2CC=C(F)CC2C=C1 |
| InChI | InChI=1S/C11H14FN/c1-2-10-5-3-8-7-9(12)4-6-11(8)13-10/h3-5,8,11H,2,6-7H2,1H3 |
| InChIKey | KKDZAQCGKDPUNU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |