About 6-fluoro-2,8a-dimethyl-8H-quinoline
6-fluoro-2,8a-dimethyl-8H-quinoline (PubChem CID 130413123) has the molecular formula C11H12FN
and a molecular weight of 177.22 g/mol. Its IUPAC name is 6-fluoro-2,8a-dimethyl-8H-quinoline.
Molecular Properties
| Compound Name | 6-fluoro-2,8a-dimethyl-8H-quinoline |
| PubChem CID | 130413123 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 6-fluoro-2,8a-dimethyl-8H-quinoline |
| SMILES | CC1=NC2(C)CC=C(F)C=C2C=C1 |
| InChI | InChI=1S/C11H12FN/c1-8-3-4-9-7-10(12)5-6-11(9,2)13-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | IDEBDJMMUDLDSP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-2,8a-dimethyl-8H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,8a-dimethyl-8H-quinoline?
The IUPAC name of 6-fluoro-2,8a-dimethyl-8H-quinoline (CID 130413123) is 6-fluoro-2,8a-dimethyl-8H-quinoline.
What is the SMILES notation for 6-fluoro-2,8a-dimethyl-8H-quinoline?
The canonical SMILES for 6-fluoro-2,8a-dimethyl-8H-quinoline is CC1=NC2(C)CC=C(F)C=C2C=C1.
What is the InChIKey of 6-fluoro-2,8a-dimethyl-8H-quinoline?
The InChIKey is IDEBDJMMUDLDSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN/c1-8-3-4-9-7-10(12)5-6-11(9,2)13-8/h3-5,7H,6H2,1-2H3.
What are the key properties of 6-fluoro-2,8a-dimethyl-8H-quinoline?
6-fluoro-2,8a-dimethyl-8H-quinoline has a molecular weight of 177.22 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,8a-dimethyl-8H-quinoline is sourced from PubChem (CID 130413123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).