C31H45N3O4 — CID 130413190
1-[(E,2E)-4,5-dimethoxy-2-(2-methoxypropylidene)hex-3-enyl]-3-[(2E,4Z)-1-[2-[(Z)-[(6Z)-6-ethylidenecyclohexa-2,4-dien-1-ylidene]methyl]prop-2-enylamino]hexa-2,4-dien-3-yl]urea (PubChem CID 130413190) has the molecular formula C31H45N3O4 and a molecular weight of 523.72 g/mol. Its IUPAC name is 1-[(E,2E)-4,5-dimethoxy-2-(2-methoxypropylidene)hex-3-enyl]-3-[(2E,4Z)-1-[2-[(Z)-[(6Z)-6-ethylidenecyclohexa-2,4-dien-1-ylidene]methyl]prop-2-enylamino]hexa-2,4-dien-3-yl]urea.
| Compound Name | 1-[(E,2E)-4,5-dimethoxy-2-(2-methoxypropylidene)hex-3-enyl]-3-[(2E,4Z)-1-[2-[(Z)-[(6Z)-6-ethylidenecyclohexa-2,4-dien-1-ylidene]methyl]prop-2-enylamino]hexa-2,4-dien-3-yl]urea |
|---|---|
| PubChem CID | 130413190 |
| Molecular Formula | C31H45N3O4 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | 1-[(E,2E)-4,5-dimethoxy-2-(2-methoxypropylidene)hex-3-enyl]-3-[(2E,4Z)-1-[2-[(Z)-[(6Z)-6-ethylidenecyclohexa-2,4-dien-1-ylidene]methyl]prop-2-enylamino]hexa-2,4-dien-3-yl]urea |
| SMILES | C=C(/C=c1/cccc/c1=C/C)CNC/C=C(\C=C/C)NC(=O)NCC(=C/C(C)OC)/C=C(/OC)C(C)OC |
| InChI | InChI=1S/C31H45N3O4/c1-9-13-29(16-17-32-21-23(3)18-28-15-12-11-14-27(28)10-2)34-31(35)33-22-26(19-24(4)36-6)20-30(38-8)25(5)37-7/h9-16,18-20,24-25,32H,3,17,21-22H2,1-2,4-8H3,(H2,33,34,35)/b13-9-,26-19+,27-10-,28-18-,29-16+,30-20+ |
| InChIKey | CVKIPAGGKIYGFH-JZZAKNGVSA-N |
| XLogP | 3.70 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|