C16H26N2S — CID 130413283
N-[(2E,4Z)-1-[[(3Z,5Z)-hepta-3,5-dienyl]amino]-2-methylhepta-2,4-dien-3-yl]methanethioamide (PubChem CID 130413283) has the molecular formula C16H26N2S and a molecular weight of 278.47 g/mol. Its IUPAC name is N-[(2E,4Z)-1-[[(3Z,5Z)-hepta-3,5-dienyl]amino]-2-methylhepta-2,4-dien-3-yl]methanethioamide.
| Compound Name | N-[(2E,4Z)-1-[[(3Z,5Z)-hepta-3,5-dienyl]amino]-2-methylhepta-2,4-dien-3-yl]methanethioamide |
|---|---|
| PubChem CID | 130413283 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-[(2E,4Z)-1-[[(3Z,5Z)-hepta-3,5-dienyl]amino]-2-methylhepta-2,4-dien-3-yl]methanethioamide |
| SMILES | C/C=C\C=C/CCNC/C(C)=C(\C=C/CC)NC=S |
| InChI | InChI=1S/C16H26N2S/c1-4-6-8-9-10-12-17-13-15(3)16(18-14-19)11-7-5-2/h4,6-9,11,14,17H,5,10,12-13H2,1-3H3,(H,18,19)/b6-4-,9-8-,11-7-,16-15+ |
| InChIKey | MCPZDYZQUCZOKW-FKUKURPBSA-N |
| XLogP | 3.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|