About 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole
4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole (PubChem CID 130413605) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole.
Molecular Properties
| Compound Name | 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole |
| PubChem CID | 130413605 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole |
| SMILES | C=C1CN=CC1C/C=C\C |
| InChI | InChI=1S/C9H13N/c1-3-4-5-9-7-10-6-8(9)2/h3-4,7,9H,2,5-6H2,1H3/b4-3- |
| InChIKey | ONZDCZOMZGJVIQ-ARJAWSKDSA-N |
| XLogP | 2.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole?
The IUPAC name of 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole (CID 130413605) is 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole.
What is the SMILES notation for 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole?
The canonical SMILES for 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole is C=C1CN=CC1C/C=C\C.
What is the InChIKey of 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole?
The InChIKey is ONZDCZOMZGJVIQ-ARJAWSKDSA-N. The full InChI is InChI=1S/C9H13N/c1-3-4-5-9-7-10-6-8(9)2/h3-4,7,9H,2,5-6H2,1H3/b4-3-.
What are the key properties of 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole?
4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole has a molecular weight of 135.21 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-but-2-enyl]-3-methylidene-2,4-dihydropyrrole is sourced from PubChem (CID 130413605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).