C34H55NO3 — CID 130413763
tert-butyl N-[(1R,5aR,5bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]carbamate (PubChem CID 130413763) has the molecular formula C34H55NO3 and a molecular weight of 525.82 g/mol. Its IUPAC name is tert-butyl N-[(1R,5aR,5bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,5aR,5bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]carbamate |
|---|---|
| PubChem CID | 130413763 |
| Molecular Formula | C34H55NO3 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 525.42 |
| IUPAC Name | tert-butyl N-[(1R,5aR,5bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-3a-yl]carbamate |
| SMILES | C=C(C)C1CCC2(NC(=O)OC(C)(C)C)CC[C@]3(C)C(CCC4C5(C)CCC(=O)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C34H55NO3/c1-21(2)22-13-18-34(35-28(37)38-29(3,4)5)20-19-32(9)23(27(22)34)11-12-25-31(8)16-15-26(36)30(6,7)24(31)14-17-33(25,32)10/h22-25,27H,1,11-20H2,2-10H3,(H,35,37)/t22?,23?,24?,25?,27?,31?,32-,33-,34?/m1/s1 |
| InChIKey | BWRYYUGGHKZDJT-AUXTXVIESA-N |
| XLogP | 8.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|