C21H25ClN4O5S — CID 130413929
(Z)-N-[[(3S,3aS)-7-(2-hydroxypiperazin-1-yl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl]-2-(1-chloroethenylsulfanyl)but-2-enamide (PubChem CID 130413929) has the molecular formula C21H25ClN4O5S and a molecular weight of 480.97 g/mol. Its IUPAC name is (Z)-N-[[(3S,3aS)-7-(2-hydroxypiperazin-1-yl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl]-2-(1-chloroethenylsulfanyl)but-2-enamide.
| Compound Name | (Z)-N-[[(3S,3aS)-7-(2-hydroxypiperazin-1-yl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl]-2-(1-chloroethenylsulfanyl)but-2-enamide |
|---|---|
| PubChem CID | 130413929 |
| Molecular Formula | C21H25ClN4O5S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | (Z)-N-[[(3S,3aS)-7-(2-hydroxypiperazin-1-yl)-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]methyl]-2-(1-chloroethenylsulfanyl)but-2-enamide |
| SMILES | C=C(Cl)S/C(=C\C)C(=O)NC[C@@H]1OC(=O)N2c3ccc(N4CCNCC4O)cc3OC[C@@H]12 |
| InChI | InChI=1S/C21H25ClN4O5S/c1-3-18(32-12(2)22)20(28)24-9-17-15-11-30-16-8-13(25-7-6-23-10-19(25)27)4-5-14(16)26(15)21(29)31-17/h3-5,8,15,17,19,23,27H,2,6-7,9-11H2,1H3,(H,24,28)/b18-3-/t15-,17-,19?/m0/s1 |
| InChIKey | VIHPNJZVKBVPSA-WHWCFIKUSA-N |
| XLogP | 1.96 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|