About 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol
1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol (PubChem CID 130413962) has the molecular formula C8H8O2S2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol.
Molecular Properties
| Compound Name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol |
| PubChem CID | 130413962 |
| Molecular Formula | C8H8O2S2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol |
| SMILES | O=S1(=O)CCc2cc(S)ccc21 |
| InChI | InChI=1S/C8H8O2S2/c9-12(10)4-3-6-5-7(11)1-2-8(6)12/h1-2,5,11H,3-4H2 |
| InChIKey | DTVMXNQMUQTOSP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol?
The IUPAC name of 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol (CID 130413962) is 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol.
What is the SMILES notation for 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol?
The canonical SMILES for 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol is O=S1(=O)CCc2cc(S)ccc21.
What is the InChIKey of 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol?
The InChIKey is DTVMXNQMUQTOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S2/c9-12(10)4-3-6-5-7(11)1-2-8(6)12/h1-2,5,11H,3-4H2.
What are the key properties of 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol?
1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol has a molecular weight of 200.28 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-2,3-dihydro-1-benzothiophene-5-thiol is sourced from PubChem (CID 130413962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).