C20H23F2N5O — CID 130414324
[2-[1-[6-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]pyrimidin-4-yl]ethenyl]-4-(1-methylcyclopropyl)oxyphenyl]hydrazine (PubChem CID 130414324) has the molecular formula C20H23F2N5O and a molecular weight of 387.43 g/mol. Its IUPAC name is [2-[1-[6-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]pyrimidin-4-yl]ethenyl]-4-(1-methylcyclopropyl)oxyphenyl]hydrazine.
| Compound Name | [2-[1-[6-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]pyrimidin-4-yl]ethenyl]-4-(1-methylcyclopropyl)oxyphenyl]hydrazine |
|---|---|
| PubChem CID | 130414324 |
| Molecular Formula | C20H23F2N5O |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | [2-[1-[6-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]pyrimidin-4-yl]ethenyl]-4-(1-methylcyclopropyl)oxyphenyl]hydrazine |
| SMILES | C=C(c1cc(N2C[C@H](F)[C@@H](F)C2)ncn1)c1cc(OC2(C)CC2)ccc1NN |
| InChI | InChI=1S/C20H23F2N5O/c1-12(14-7-13(3-4-17(14)26-23)28-20(2)5-6-20)18-8-19(25-11-24-18)27-9-15(21)16(22)10-27/h3-4,7-8,11,15-16,26H,1,5-6,9-10,23H2,2H3/t15-,16-/m0/s1 |
| InChIKey | JPLJQRAHUJUONZ-HOTGVXAUSA-N |
| XLogP | 3.25 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|