C22H29N5O3 — CID 130414441
2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(3-ethyloxetan-3-yl)oxyaniline (PubChem CID 130414441) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(3-ethyloxetan-3-yl)oxyaniline.
| Compound Name | 2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(3-ethyloxetan-3-yl)oxyaniline |
|---|---|
| PubChem CID | 130414441 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 2-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidine-4-carboximidoyl]-4-(3-ethyloxetan-3-yl)oxyaniline |
| SMILES | [H]/N=C(\c1cc(N2C[C@@H](C)O[C@@H](C)C2)ncn1)c1cc(OC2(CC)COC2)ccc1N |
| InChI | InChI=1S/C22H29N5O3/c1-4-22(11-28-12-22)30-16-5-6-18(23)17(7-16)21(24)19-8-20(26-13-25-19)27-9-14(2)29-15(3)10-27/h5-8,13-15,24H,4,9-12,23H2,1-3H3/b24-21-/t14-,15+ |
| InChIKey | RTNYEJFLKDQDCJ-FDLSJUPPSA-N |
| XLogP | 2.65 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|