About 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine
4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine (PubChem CID 130414536) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine.
Molecular Properties
| Compound Name | 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine |
| PubChem CID | 130414536 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine |
| SMILES | COC1=CCC(N)=CC=C1C(C)(C)C |
| InChI | InChI=1S/C12H19NO/c1-12(2,3)10-7-5-9(13)6-8-11(10)14-4/h5,7-8H,6,13H2,1-4H3 |
| InChIKey | AFRUFIRRRSZIOO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine?
The IUPAC name of 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine (CID 130414536) is 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine.
What is the SMILES notation for 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine?
The canonical SMILES for 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine is COC1=CCC(N)=CC=C1C(C)(C)C.
What is the InChIKey of 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine?
The InChIKey is AFRUFIRRRSZIOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-12(2,3)10-7-5-9(13)6-8-11(10)14-4/h5,7-8H,6,13H2,1-4H3.
What are the key properties of 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine?
4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine has a molecular weight of 193.29 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-5-methoxycyclohepta-1,3,5-trien-1-amine is sourced from PubChem (CID 130414536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).