C35H38N6O3 — CID 130415039
tert-butyl (2S)-2-[6-[7-[2-(propylaminomethyl)-1H-imidazol-5-yl]dibenzofuran-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 130415039) has the molecular formula C35H38N6O3 and a molecular weight of 590.73 g/mol. Its IUPAC name is tert-butyl (2S)-2-[6-[7-[2-(propylaminomethyl)-1H-imidazol-5-yl]dibenzofuran-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[6-[7-[2-(propylaminomethyl)-1H-imidazol-5-yl]dibenzofuran-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 130415039 |
| Molecular Formula | C35H38N6O3 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | tert-butyl (2S)-2-[6-[7-[2-(propylaminomethyl)-1H-imidazol-5-yl]dibenzofuran-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CCCNCc1ncc(-c2ccc3c(c2)oc2cc(-c4ccc5nc([C@@H]6CCCN6C(=O)OC(C)(C)C)[nH]c5c4)ccc23)[nH]1 |
| InChI | InChI=1S/C35H38N6O3/c1-5-14-36-20-32-37-19-28(38-32)23-9-12-25-24-11-8-22(17-30(24)43-31(25)18-23)21-10-13-26-27(16-21)40-33(39-26)29-7-6-15-41(29)34(42)44-35(2,3)4/h8-13,16-19,29,36H,5-7,14-15,20H2,1-4H3,(H,37,38)(H,39,40)/t29-/m0/s1 |
| InChIKey | INNWEQYPFHEZNU-LJAQVGFWSA-N |
| XLogP | 8.09 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|