About benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate
benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate (PubChem CID 130416519) has the molecular formula C31H32F2N2O4
and a molecular weight of 534.60 g/mol. Its IUPAC name is benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate.
Molecular Properties
| Compound Name | benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate |
| PubChem CID | 130416519 |
| Molecular Formula | C31H32F2N2O4 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2(OCCO2)C2(CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)C2)C1 |
| InChI | InChI=1S/C31H32F2N2O4/c32-26-10-6-24(7-11-26)28(25-8-12-27(33)13-9-25)34-16-14-30(21-34)22-35(17-15-31(30)38-18-19-39-31)29(36)37-20-23-4-2-1-3-5-23/h1-13,28H,14-22H2 |
| InChIKey | ATSOVFOCNQADBW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate?
The IUPAC name of benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate (CID 130416519) is benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate.
What is the SMILES notation for benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate?
The canonical SMILES for benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate is O=C(OCc1ccccc1)N1CCC2(OCCO2)C2(CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)C2)C1.
What is the InChIKey of benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate?
The InChIKey is ATSOVFOCNQADBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H32F2N2O4/c32-26-10-6-24(7-11-26)28(25-8-12-27(33)13-9-25)34-16-14-30(21-34)22-35(17-15-31(30)38-18-19-39-31)29(36)37-20-23-4-2-1-3-5-23/h1-13,28H,14-22H2.
What are the key properties of benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate?
benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate has a molecular weight of 534.60 g/mol, XLogP of 5.53, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-[bis(4-fluorophenyl)methyl]-7,10-dioxa-3,13-diazadispiro[4.0.46.45]tetradecane-13-carboxylate is sourced from PubChem (CID 130416519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).