C21H16N2O12P2 — CID 130416763
2-[[3-(1,3-dioxoisoindol-2-yl)oxy-3,9-dioxo-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecan-9-yl]oxy]isoindole-1,3-dione (PubChem CID 130416763) has the molecular formula C21H16N2O12P2 and a molecular weight of 550.31 g/mol. Its IUPAC name is 2-[[3-(1,3-dioxoisoindol-2-yl)oxy-3,9-dioxo-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecan-9-yl]oxy]isoindole-1,3-dione.
| Compound Name | 2-[[3-(1,3-dioxoisoindol-2-yl)oxy-3,9-dioxo-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecan-9-yl]oxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 130416763 |
| Molecular Formula | C21H16N2O12P2 |
| Molecular Weight | 550.31 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | 2-[[3-(1,3-dioxoisoindol-2-yl)oxy-3,9-dioxo-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecan-9-yl]oxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OP1(=O)OCC2(CO1)COP(=O)(ON1C(=O)c3ccccc3C1=O)OC2 |
| InChI | InChI=1S/C21H16N2O12P2/c24-17-13-5-1-2-6-14(13)18(25)22(17)34-36(28)30-9-21(10-31-36)11-32-37(29,33-12-21)35-23-19(26)15-7-3-4-8-16(15)20(23)27/h1-8H,9-12H2 |
| InChIKey | BFLPCTKQYXHFHN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 164.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|