C26H24F2N6O2 — CID 130417013
1-[(4-ethoxy-2,6-difluorophenyl)methyl]-N'-[(E)-2-methoxy-1-(pyridin-4-ylamino)ethenyl]-N-methylideneindazole-3-carboximidamide (PubChem CID 130417013) has the molecular formula C26H24F2N6O2 and a molecular weight of 490.51 g/mol. Its IUPAC name is 1-[(4-ethoxy-2,6-difluorophenyl)methyl]-N'-[(E)-2-methoxy-1-(pyridin-4-ylamino)ethenyl]-N-methylideneindazole-3-carboximidamide.
| Compound Name | 1-[(4-ethoxy-2,6-difluorophenyl)methyl]-N'-[(E)-2-methoxy-1-(pyridin-4-ylamino)ethenyl]-N-methylideneindazole-3-carboximidamide |
|---|---|
| PubChem CID | 130417013 |
| Molecular Formula | C26H24F2N6O2 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 1-[(4-ethoxy-2,6-difluorophenyl)methyl]-N'-[(E)-2-methoxy-1-(pyridin-4-ylamino)ethenyl]-N-methylideneindazole-3-carboximidamide |
| SMILES | C=N/C(=N\C(=C\OC)Nc1ccncc1)c1nn(Cc2c(F)cc(OCC)cc2F)c2ccccc12 |
| InChI | InChI=1S/C26H24F2N6O2/c1-4-36-18-13-21(27)20(22(28)14-18)15-34-23-8-6-5-7-19(23)25(33-34)26(29-2)32-24(16-35-3)31-17-9-11-30-12-10-17/h5-14,16H,2,4,15H2,1,3H3,(H,30,31)/b24-16+,32-26- |
| InChIKey | KYVXAFASERGLBU-HFXRPDNNSA-N |
| XLogP | 5.16 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|