C26H19F7N6O2 — CID 130417017
N'-[(E)-2-methoxy-1-(pyridin-4-ylamino)ethenyl]-N-methylidene-1-[[2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]indazole-3-carboximidamide (PubChem CID 130417017) has the molecular formula C26H19F7N6O2 and a molecular weight of 580.46 g/mol. Its IUPAC name is N'-[(E)-2-methoxy-1-(pyridin-4-ylamino)ethenyl]-N-methylidene-1-[[2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]indazole-3-carboximidamide.
| Compound Name | N'-[(E)-2-methoxy-1-(pyridin-4-ylamino)ethenyl]-N-methylidene-1-[[2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]indazole-3-carboximidamide |
|---|---|
| PubChem CID | 130417017 |
| Molecular Formula | C26H19F7N6O2 |
| Molecular Weight | 580.46 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | N'-[(E)-2-methoxy-1-(pyridin-4-ylamino)ethenyl]-N-methylidene-1-[[2,3,5,6-tetrafluoro-4-(2,2,2-trifluoroethoxy)phenyl]methyl]indazole-3-carboximidamide |
| SMILES | C=N/C(=N\C(=C\OC)Nc1ccncc1)c1nn(Cc2c(F)c(F)c(OCC(F)(F)F)c(F)c2F)c2ccccc12 |
| InChI | InChI=1S/C26H19F7N6O2/c1-34-25(37-18(12-40-2)36-14-7-9-35-10-8-14)23-15-5-3-4-6-17(15)39(38-23)11-16-19(27)21(29)24(22(30)20(16)28)41-13-26(31,32)33/h3-10,12H,1,11,13H2,2H3,(H,35,36)/b18-12+,37-25- |
| InChIKey | UHRCEMNAOZKSMM-MGKPIMCQSA-N |
| XLogP | 5.98 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|