C47H33F3N4O4 — CID 130417548
2-(9-ethylcarbazol-3-yl)-5-[2-[2-(9-ethylcarbazol-3-yl)-1,3-dioxoisoindol-5-yl]-1,1,1-trifluoropropan-2-yl]isoindole-1,3-dione (PubChem CID 130417548) has the molecular formula C47H33F3N4O4 and a molecular weight of 774.80 g/mol. Its IUPAC name is 2-(9-ethylcarbazol-3-yl)-5-[2-[2-(9-ethylcarbazol-3-yl)-1,3-dioxoisoindol-5-yl]-1,1,1-trifluoropropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-(9-ethylcarbazol-3-yl)-5-[2-[2-(9-ethylcarbazol-3-yl)-1,3-dioxoisoindol-5-yl]-1,1,1-trifluoropropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 130417548 |
| Molecular Formula | C47H33F3N4O4 |
| Molecular Weight | 774.80 g/mol |
| Exact Mass | 774.25 |
| IUPAC Name | 2-(9-ethylcarbazol-3-yl)-5-[2-[2-(9-ethylcarbazol-3-yl)-1,3-dioxoisoindol-5-yl]-1,1,1-trifluoropropan-2-yl]isoindole-1,3-dione |
| SMILES | CCn1c2ccccc2c2cc(N3C(=O)c4ccc(C(C)(c5ccc6c(c5)C(=O)N(c5ccc7c(c5)c5ccccc5n7CC)C6=O)C(F)(F)F)cc4C3=O)ccc21 |
| InChI | InChI=1S/C47H33F3N4O4/c1-4-51-38-12-8-6-10-30(38)34-24-28(16-20-40(34)51)53-42(55)32-18-14-26(22-36(32)44(53)57)46(3,47(48,49)50)27-15-19-33-37(23-27)45(58)54(43(33)56)29-17-21-41-35(25-29)31-11-7-9-13-39(31)52(41)5-2/h6-25H,4-5H2,1-3H3 |
| InChIKey | HUAXCEOLSRMFNF-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.80 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|