About [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate
[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate (PubChem CID 130417620) has the molecular formula C18H19NO5
and a molecular weight of 329.35 g/mol. Its IUPAC name is [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate |
| PubChem CID | 130417620 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/COC(=O)c1cccnc1 |
| InChI | InChI=1S/C18H19NO5/c1-21-15-11-17(23-3)16(22-2)10-13(15)7-5-9-24-18(20)14-6-4-8-19-12-14/h4-8,10-12H,9H2,1-3H3/b7-5+ |
| InChIKey | GVMBMKUKYNQUJN-FNORWQNLSA-N |
| XLogP | 2.98 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate?
The IUPAC name of [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate (CID 130417620) is [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate.
What is the SMILES notation for [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate?
The canonical SMILES for [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate is COc1cc(OC)c(OC)cc1/C=C/COC(=O)c1cccnc1.
What is the InChIKey of [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate?
The InChIKey is GVMBMKUKYNQUJN-FNORWQNLSA-N. The full InChI is InChI=1S/C18H19NO5/c1-21-15-11-17(23-3)16(22-2)10-13(15)7-5-9-24-18(20)14-6-4-8-19-12-14/h4-8,10-12H,9H2,1-3H3/b7-5+.
What are the key properties of [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate?
[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate has a molecular weight of 329.35 g/mol, XLogP of 2.98, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] pyridine-3-carboxylate is sourced from PubChem (CID 130417620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).