C25H23NO5 — CID 130417646
8-[[(2S,3R,4R)-3,6-dihydroxy-2-methyloxan-4-yl]amino]-3-methylbenzo[a]anthracene-7,12-dione (PubChem CID 130417646) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is 8-[[(2S,3R,4R)-3,6-dihydroxy-2-methyloxan-4-yl]amino]-3-methylbenzo[a]anthracene-7,12-dione.
| Compound Name | 8-[[(2S,3R,4R)-3,6-dihydroxy-2-methyloxan-4-yl]amino]-3-methylbenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 130417646 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 8-[[(2S,3R,4R)-3,6-dihydroxy-2-methyloxan-4-yl]amino]-3-methylbenzo[a]anthracene-7,12-dione |
| SMILES | Cc1ccc2c3c(ccc2c1)C(=O)c1c(N[C@@H]2CC(O)O[C@@H](C)[C@@H]2O)cccc1C3=O |
| InChI | InChI=1S/C25H23NO5/c1-12-6-8-15-14(10-12)7-9-17-21(15)24(29)16-4-3-5-18(22(16)25(17)30)26-19-11-20(27)31-13(2)23(19)28/h3-10,13,19-20,23,26-28H,11H2,1-2H3/t13-,19+,20?,23-/m0/s1 |
| InChIKey | CPYDAFSSSVVZAX-SYXNFKNLSA-N |
| XLogP | 3.19 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|