C6H10N2O6 — CID 130417652
4,6-dinitrosocyclohexane-1,2,3,5-tetrol (PubChem CID 130417652) has the molecular formula C6H10N2O6 and a molecular weight of 206.15 g/mol. Its IUPAC name is 4,6-dinitrosocyclohexane-1,2,3,5-tetrol.
| Compound Name | 4,6-dinitrosocyclohexane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 130417652 |
| Molecular Formula | C6H10N2O6 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 4,6-dinitrosocyclohexane-1,2,3,5-tetrol |
| SMILES | O=NC1C(O)C(O)C(O)C(N=O)C1O |
| InChI | InChI=1S/C6H10N2O6/c9-3-1(7-13)4(10)6(12)5(11)2(3)8-14/h1-6,9-12H |
| InChIKey | KEQDOCQFMJUIQN-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |