About Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate
Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate (PubChem CID 130417693) has the molecular formula C20H20N2O2S
and a molecular weight of 352.50 g/mol. Its IUPAC name is ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate |
| PubChem CID | 130417693 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate |
| SMILES | CCOC(=O)C1=NC=C(N=C1)C#CC2=CC3=C(C=C2)SCCC3(C)C |
| InChI | InChI=1S/C20H20N2O2S/c1-4-24-19(23)17-13-21-15(12-22-17)7-5-14-6-8-18-16(11-14)20(2,3)9-10-25-18/h6,8,11-13H,4,9-10H2,1-3H3 |
| InChIKey | VEWUCWFWGWLAMR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 77.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 550 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate?
The IUPAC name of Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate (CID 130417693) is ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate.
What is the SMILES notation for Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate?
The canonical SMILES for Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate is CCOC(=O)C1=NC=C(N=C1)C#CC2=CC3=C(C=C2)SCCC3(C)C.
What is the InChIKey of Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate?
The InChIKey is VEWUCWFWGWLAMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2S/c1-4-24-19(23)17-13-21-15(12-22-17)7-5-14-6-8-18-16(11-14)20(2,3)9-10-25-18/h6,8,11-13H,4,9-10H2,1-3H3.
What are the key properties of Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate?
Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate has a molecular weight of 352.50 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazine-2-carboxylate is sourced from PubChem (CID 130417693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).