About Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate
Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate (PubChem CID 130417701) has the molecular formula C19H18N2O2S
and a molecular weight of 338.40 g/mol. Its IUPAC name is methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate |
| PubChem CID | 130417701 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate |
| SMILES | CC1(CCSC2=C1C=C(C=C2)C#CC3=CN=C(N=C3)C(=O)OC)C |
| InChI | InChI=1S/C19H18N2O2S/c1-19(2)8-9-24-16-7-6-13(10-15(16)19)4-5-14-11-20-17(21-12-14)18(22)23-3/h6-7,10-12H,8-9H2,1-3H3 |
| InChIKey | SSIHHWDUIDAHBR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 77.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | 528 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate?
The IUPAC name of Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate (CID 130417701) is methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate.
What is the SMILES notation for Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate?
The canonical SMILES for Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate is CC1(CCSC2=C1C=C(C=C2)C#CC3=CN=C(N=C3)C(=O)OC)C.
What is the InChIKey of Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate?
The InChIKey is SSIHHWDUIDAHBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2S/c1-19(2)8-9-24-16-7-6-13(10-15(16)19)4-5-14-11-20-17(21-12-14)18(22)23-3/h6-7,10-12H,8-9H2,1-3H3.
What are the key properties of Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate?
Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate has a molecular weight of 338.40 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl 5-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-2-carboxylate is sourced from PubChem (CID 130417701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).