About 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid
4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid (PubChem CID 130417922) has the molecular formula C27H23Cl2N3O3
and a molecular weight of 508.41 g/mol. Its IUPAC name is 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid |
| PubChem CID | 130417922 |
| Molecular Formula | C27H23Cl2N3O3 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid |
| SMILES | Cn1c(C(=O)NC2(c3ccc(C(=O)O)cc3)CCN(c3ccccc3)C2)cc2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C27H23Cl2N3O3/c1-31-22-12-11-21(28)24(29)20(22)15-23(31)25(33)30-27(18-9-7-17(8-10-18)26(34)35)13-14-32(16-27)19-5-3-2-4-6-19/h2-12,15H,13-14,16H2,1H3,(H,30,33)(H,34,35) |
| InChIKey | JQLVOKOWIONDPK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid?
The IUPAC name of 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid (CID 130417922) is 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid.
What is the SMILES notation for 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid?
The canonical SMILES for 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid is Cn1c(C(=O)NC2(c3ccc(C(=O)O)cc3)CCN(c3ccccc3)C2)cc2c(Cl)c(Cl)ccc21.
What is the InChIKey of 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid?
The InChIKey is JQLVOKOWIONDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23Cl2N3O3/c1-31-22-12-11-21(28)24(29)20(22)15-23(31)25(33)30-27(18-9-7-17(8-10-18)26(34)35)13-14-32(16-27)19-5-3-2-4-6-19/h2-12,15H,13-14,16H2,1H3,(H,30,33)(H,34,35).
What are the key properties of 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid?
4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid has a molecular weight of 508.41 g/mol, XLogP of 5.72, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoic acid is sourced from PubChem (CID 130417922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).