C16H17NO2 — CID 130418101
2-[(2Z,4Z)-4-methylhepta-2,4,6-trien-3-yl]-3a,7a-dihydroisoindole-1,3-dione (PubChem CID 130418101) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[(2Z,4Z)-4-methylhepta-2,4,6-trien-3-yl]-3a,7a-dihydroisoindole-1,3-dione.
| Compound Name | 2-[(2Z,4Z)-4-methylhepta-2,4,6-trien-3-yl]-3a,7a-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 130418101 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-[(2Z,4Z)-4-methylhepta-2,4,6-trien-3-yl]-3a,7a-dihydroisoindole-1,3-dione |
| SMILES | C=C/C=C(C)\C(=C\C)N1C(=O)C2C=CC=CC2C1=O |
| InChI | InChI=1S/C16H17NO2/c1-4-8-11(3)14(5-2)17-15(18)12-9-6-7-10-13(12)16(17)19/h4-10,12-13H,1H2,2-3H3/b11-8-,14-5- |
| InChIKey | KRYOVSPUJIPCIZ-UMXNAHBMSA-N |
| XLogP | 2.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|