About methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate
methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate (PubChem CID 130418154) has the molecular formula C22H21Cl2N3O3
and a molecular weight of 446.33 g/mol. Its IUPAC name is methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate |
| PubChem CID | 130418154 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2(NC(=O)c3cc4c(Cl)c(Cl)ccc4n3C)CCNC2)cc1 |
| InChI | InChI=1S/C22H21Cl2N3O3/c1-27-17-8-7-16(23)19(24)15(17)11-18(27)20(28)26-22(9-10-25-12-22)14-5-3-13(4-6-14)21(29)30-2/h3-8,11,25H,9-10,12H2,1-2H3,(H,26,28) |
| InChIKey | IFJUEPMERNXPOH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate?
The IUPAC name of methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate (CID 130418154) is methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate.
What is the SMILES notation for methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate?
The canonical SMILES for methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate is COC(=O)c1ccc(C2(NC(=O)c3cc4c(Cl)c(Cl)ccc4n3C)CCNC2)cc1.
What is the InChIKey of methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate?
The InChIKey is IFJUEPMERNXPOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21Cl2N3O3/c1-27-17-8-7-16(23)19(24)15(17)11-18(27)20(28)26-22(9-10-25-12-22)14-5-3-13(4-6-14)21(29)30-2/h3-8,11,25H,9-10,12H2,1-2H3,(H,26,28).
What are the key properties of methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate?
methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate has a molecular weight of 446.33 g/mol, XLogP of 3.89, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]pyrrolidin-3-yl]benzoate is sourced from PubChem (CID 130418154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).