About methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate
methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate (PubChem CID 130418155) has the molecular formula C28H25Cl2N3O3
and a molecular weight of 522.43 g/mol. Its IUPAC name is methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate |
| PubChem CID | 130418155 |
| Molecular Formula | C28H25Cl2N3O3 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2(NC(=O)c3cc4c(Cl)c(Cl)ccc4n3C)CCN(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C28H25Cl2N3O3/c1-32-23-13-12-22(29)25(30)21(23)16-24(32)26(34)31-28(19-10-8-18(9-11-19)27(35)36-2)14-15-33(17-28)20-6-4-3-5-7-20/h3-13,16H,14-15,17H2,1-2H3,(H,31,34) |
| InChIKey | UHBFUENVODTKJM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate?
The IUPAC name of methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate (CID 130418155) is methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate.
What is the SMILES notation for methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate?
The canonical SMILES for methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate is COC(=O)c1ccc(C2(NC(=O)c3cc4c(Cl)c(Cl)ccc4n3C)CCN(c3ccccc3)C2)cc1.
What is the InChIKey of methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate?
The InChIKey is UHBFUENVODTKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25Cl2N3O3/c1-32-23-13-12-22(29)25(30)21(23)16-24(32)26(34)31-28(19-10-8-18(9-11-19)27(35)36-2)14-15-33(17-28)20-6-4-3-5-7-20/h3-13,16H,14-15,17H2,1-2H3,(H,31,34).
What are the key properties of methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate?
methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate has a molecular weight of 522.43 g/mol, XLogP of 5.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]-1-phenylpyrrolidin-3-yl]benzoate is sourced from PubChem (CID 130418155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).