About 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one
5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 13041833) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
Analyze 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one?
The IUPAC name of 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (CID 13041833) is 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
What is the SMILES notation for 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one?
The canonical SMILES for 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one is O=C1CC2CC(O)CC2C1.
What is the InChIKey of 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one?
The InChIKey is PQWWWWBPUGFVIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c9-7-1-5-2-8(10)4-6(5)3-7/h5-7,9H,1-4H2.
What are the key properties of 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one?
5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one has a molecular weight of 140.18 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one is sourced from PubChem (CID 13041833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).