C11H14F9NO2 — CID 130418338
4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]morpholine (PubChem CID 130418338) has the molecular formula C11H14F9NO2 and a molecular weight of 363.22 g/mol. Its IUPAC name is 4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]morpholine.
| Compound Name | 4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]morpholine |
|---|---|
| PubChem CID | 130418338 |
| Molecular Formula | C11H14F9NO2 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]morpholine |
| SMILES | FC(N1CCOCC1)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F9NO2/c12-7(11(18,19)20)9(14,15)5-23-6-10(16,17)8(13)21-1-3-22-4-2-21/h7-8H,1-6H2 |
| InChIKey | STWHOCSLFAKXQM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|