C12H14F12N2O — CID 130418339
1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-4-(trifluoromethyl)piperazine (PubChem CID 130418339) has the molecular formula C12H14F12N2O and a molecular weight of 430.23 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-4-(trifluoromethyl)piperazine.
| Compound Name | 1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 130418339 |
| Molecular Formula | C12H14F12N2O |
| Molecular Weight | 430.23 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-4-(trifluoromethyl)piperazine |
| SMILES | FC(N1CCN(C(F)(F)F)CC1)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F12N2O/c13-7(11(19,20)21)9(15,16)5-27-6-10(17,18)8(14)25-1-3-26(4-2-25)12(22,23)24/h7-8H,1-6H2 |
| InChIKey | SLAHUKSSUVNHRA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|