C14H14F15NO — CID 130418342
1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 130418342) has the molecular formula C14H14F15NO and a molecular weight of 497.24 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 130418342 |
| Molecular Formula | C14H14F15NO |
| Molecular Weight | 497.24 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | FC(N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C14H14F15NO/c15-8(14(27,28)29)10(17,18)4-31-5-11(19,20)9(16)30-2-6(12(21,22)23)1-7(3-30)13(24,25)26/h6-9H,1-5H2 |
| InChIKey | QTSMYYRCDWRWQK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.24 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|