C13H16F11NO — CID 130418344
1-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]piperidine (PubChem CID 130418344) has the molecular formula C13H16F11NO and a molecular weight of 411.26 g/mol. Its IUPAC name is 1-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]piperidine.
| Compound Name | 1-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]piperidine |
|---|---|
| PubChem CID | 130418344 |
| Molecular Formula | C13H16F11NO |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 1-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]piperidine |
| SMILES | FC(C(F)(F)F)C(F)(F)COCC(F)(F)C(N1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C13H16F11NO/c14-8(12(19,20)21)10(15,16)6-26-7-11(17,18)9(13(22,23)24)25-4-2-1-3-5-25/h8-9H,1-7H2 |
| InChIKey | BREKDUPWAQJBFC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |