About 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine
1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 130418355) has the molecular formula C9H9F8N
and a molecular weight of 283.16 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine.
Molecular Properties
| Compound Name | 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine |
| PubChem CID | 130418355 |
| Molecular Formula | C9H9F8N |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | F/C=C(/F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H9F8N/c10-2-7(11)18-3-5(8(12,13)14)1-6(4-18)9(15,16)17/h2,5-6H,1,3-4H2/b7-2- |
| InChIKey | SIARKIAYHDWGMR-UQCOIBPSSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine?
The IUPAC name of 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine (CID 130418355) is 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine.
What is the SMILES notation for 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine?
The canonical SMILES for 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine is F/C=C(/F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1.
What is the InChIKey of 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine?
The InChIKey is SIARKIAYHDWGMR-UQCOIBPSSA-N. The full InChI is InChI=1S/C9H9F8N/c10-2-7(11)18-3-5(8(12,13)14)1-6(4-18)9(15,16)17/h2,5-6H,1,3-4H2/b7-2-.
What are the key properties of 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine?
1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine has a molecular weight of 283.16 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1,2-difluoroethenyl]-3,5-bis(trifluoromethyl)piperidine is sourced from PubChem (CID 130418355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).