C13H17F11N2O — CID 130418360
1,1,1,2,3,3-hexafluoro-4-[(2S)-2,3,3,3-tetrafluoro-2-[fluoro(piperidin-1-yl)methyl]propoxy]butan-2-amine (PubChem CID 130418360) has the molecular formula C13H17F11N2O and a molecular weight of 426.27 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-4-[(2S)-2,3,3,3-tetrafluoro-2-[fluoro(piperidin-1-yl)methyl]propoxy]butan-2-amine.
| Compound Name | 1,1,1,2,3,3-hexafluoro-4-[(2S)-2,3,3,3-tetrafluoro-2-[fluoro(piperidin-1-yl)methyl]propoxy]butan-2-amine |
|---|---|
| PubChem CID | 130418360 |
| Molecular Formula | C13H17F11N2O |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-4-[(2S)-2,3,3,3-tetrafluoro-2-[fluoro(piperidin-1-yl)methyl]propoxy]butan-2-amine |
| SMILES | NC(F)(C(F)(F)F)C(F)(F)COC[C@](F)(C(F)N1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C13H17F11N2O/c14-8(26-4-2-1-3-5-26)9(15,12(19,20)21)6-27-7-10(16,17)11(18,25)13(22,23)24/h8H,1-7,25H2/t8?,9-,11?/m0/s1 |
| InChIKey | AASZJUASJHSEBT-YUCVTWSNSA-N |
| XLogP | 3.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|