C13H14F14N2O — CID 130418364
1-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]-4-(trifluoromethyl)piperazine (PubChem CID 130418364) has the molecular formula C13H14F14N2O and a molecular weight of 480.24 g/mol. Its IUPAC name is 1-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]-4-(trifluoromethyl)piperazine.
| Compound Name | 1-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 130418364 |
| Molecular Formula | C13H14F14N2O |
| Molecular Weight | 480.24 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 1-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]-4-(trifluoromethyl)piperazine |
| SMILES | FC(C(F)(F)F)C(F)(F)COCC(F)(C(F)N1CCN(C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H14F14N2O/c14-7(11(19,20)21)10(17,18)6-30-5-9(16,12(22,23)24)8(15)28-1-3-29(4-2-28)13(25,26)27/h7-8H,1-6H2 |
| InChIKey | UBUKITNGNRSKBK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.24 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|